![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
These are the files that were used to produce the video for nested decision structures and compound boolean expressions.
brian
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| prob07a.pas | 2016-02-26 19:18 | 951 | |
| prob07b.pas | 2016-02-26 19:26 | 809 | |
| prob07pseudo_a.txt | 2016-02-26 19:32 | 1.3K | |
| prob07pseudo_b.txt | 2016-02-26 19:45 | 1.2K | |
| prob07b.exe | 2016-02-26 19:48 | 43K | |
| prob07a.exe | 2016-02-26 20:13 | 43K | |
| HEADER.md | 2016-02-26 22:10 | 160 | |
| HEADER.html | 2016-02-26 22:10 | 235 | |